C21H27N3O2S — CID 51265442
2-methyl-N-[3-oxo-3-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]propyl]benzamide (PubChem CID 51265442) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 2-methyl-N-[3-oxo-3-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]propyl]benzamide.
| Compound Name | 2-methyl-N-[3-oxo-3-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 51265442 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-methyl-N-[3-oxo-3-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]propyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NCCC(=O)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C21H27N3O2S/c1-16-7-2-3-8-17(16)21(26)22-11-10-20(25)23-15-18(19-9-6-14-27-19)24-12-4-5-13-24/h2-3,6-9,14,18H,4-5,10-13,15H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | AVECQFSEILWGAU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |