C20H28N4S2 — CID 30726015
1-[(2R)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-3-(2-phenylethyl)thiourea (PubChem CID 30726015) has the molecular formula C20H28N4S2 and a molecular weight of 388.61 g/mol. Its IUPAC name is 1-[(2R)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[(2R)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 30726015 |
| Molecular Formula | C20H28N4S2 |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[(2R)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-3-(2-phenylethyl)thiourea |
| SMILES | CN1CCN([C@H](CNC(=S)NCCc2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C20H28N4S2/c1-23-11-13-24(14-12-23)18(19-8-5-15-26-19)16-22-20(25)21-10-9-17-6-3-2-4-7-17/h2-8,15,18H,9-14,16H2,1H3,(H2,21,22,25)/t18-/m1/s1 |
| InChIKey | CLCICEDAPOAWFO-GOSISDBHSA-N |
| XLogP | 2.74 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|