C20H27N3S2 — CID 2330849
1-(2-phenylethyl)-3-[(1R,2S)-1-pyrrolidin-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 2330849) has the molecular formula C20H27N3S2 and a molecular weight of 373.59 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-[(1R,2S)-1-pyrrolidin-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(2-phenylethyl)-3-[(1R,2S)-1-pyrrolidin-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 2330849 |
| Molecular Formula | C20H27N3S2 |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-(2-phenylethyl)-3-[(1R,2S)-1-pyrrolidin-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | C[C@H](NC(=S)NCCc1ccccc1)[C@H](c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C20H27N3S2/c1-16(19(18-10-7-15-25-18)23-13-5-6-14-23)22-20(24)21-12-11-17-8-3-2-4-9-17/h2-4,7-10,15-16,19H,5-6,11-14H2,1H3,(H2,21,22,24)/t16-,19+/m0/s1 |
| InChIKey | NRQMKRQAOPNFFE-QFBILLFUSA-N |
| XLogP | 3.98 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|