C29H36N4O4S — CID 98142628
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(1R,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 98142628) has the molecular formula C29H36N4O4S and a molecular weight of 536.70 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(1R,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(1R,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 98142628 |
| Molecular Formula | C29H36N4O4S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(1R,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)N[C@H](C)[C@H](c2cccs2)N2CCN(c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C29H36N4O4S/c1-21(31-29(35)28(34)30-14-13-22-11-12-24(36-2)25(20-22)37-3)27(26-10-7-19-38-26)33-17-15-32(16-18-33)23-8-5-4-6-9-23/h4-12,19-21,27H,13-18H2,1-3H3,(H,30,34)(H,31,35)/t21-,27-/m1/s1 |
| InChIKey | YKKLJSUXZMODEZ-JIPXPUAJSA-N |
| XLogP | 3.49 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|