C25H35N5O3S — CID 28821063
N-(2-morpholin-4-ylethyl)-N'-[(1S,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 28821063) has the molecular formula C25H35N5O3S and a molecular weight of 485.65 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-N'-[(1S,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-N'-[(1S,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 28821063 |
| Molecular Formula | C25H35N5O3S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-N'-[(1S,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)NCCN1CCOCC1)[C@@H](c1cccs1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H35N5O3S/c1-20(27-25(32)24(31)26-9-10-28-15-17-33-18-16-28)23(22-8-5-19-34-22)30-13-11-29(12-14-30)21-6-3-2-4-7-21/h2-8,19-20,23H,9-18H2,1H3,(H,26,31)(H,27,32)/t20-,23+/m1/s1 |
| InChIKey | MSCZGDYLEVUKRP-OFNKIYASSA-N |
| XLogP | 1.56 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|