C25H34FN5O3S — CID 92665947
N'-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 92665947) has the molecular formula C25H34FN5O3S and a molecular weight of 503.64 g/mol. Its IUPAC name is N'-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 92665947 |
| Molecular Formula | C25H34FN5O3S |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N'-[(1R,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | C[C@H](NC(=O)C(=O)NCCN1CCOCC1)[C@H](c1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H34FN5O3S/c1-19(28-25(33)24(32)27-8-9-29-14-16-34-17-15-29)23(22-7-4-18-35-22)31-12-10-30(11-13-31)21-6-3-2-5-20(21)26/h2-7,18-19,23H,8-17H2,1H3,(H,27,32)(H,28,33)/t19-,23+/m0/s1 |
| InChIKey | FVUZRTBNBXYYBU-WMZHIEFXSA-N |
| XLogP | 1.70 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|