C29H32FN5O2S — CID 92906446
N'-[(1R,2R)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 92906446) has the molecular formula C29H32FN5O2S and a molecular weight of 533.67 g/mol. Its IUPAC name is N'-[(1R,2R)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[(1R,2R)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 92906446 |
| Molecular Formula | C29H32FN5O2S |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | N'-[(1R,2R)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)NCCc1c[nH]c2ccccc12)[C@H](c1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C29H32FN5O2S/c1-20(33-29(37)28(36)31-13-12-21-19-32-24-9-4-2-7-22(21)24)27(26-11-6-18-38-26)35-16-14-34(15-17-35)25-10-5-3-8-23(25)30/h2-11,18-20,27,32H,12-17H2,1H3,(H,31,36)(H,33,37)/t20-,27-/m1/s1 |
| InChIKey | SPJTXQLADGIDHF-NFQMXDRXSA-N |
| XLogP | 4.10 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|