C30H35N5O3S — CID 98209355
N-[2-(1H-indol-3-yl)ethyl]-N'-[(1S,2S)-1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 98209355) has the molecular formula C30H35N5O3S and a molecular weight of 545.71 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N'-[(1S,2S)-1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[(1S,2S)-1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 98209355 |
| Molecular Formula | C30H35N5O3S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[(1S,2S)-1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | COc1ccccc1N1CCN([C@H](c2cccs2)[C@H](C)NC(=O)C(=O)NCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C30H35N5O3S/c1-21(33-30(37)29(36)31-14-13-22-20-32-24-9-4-3-8-23(22)24)28(27-12-7-19-39-27)35-17-15-34(16-18-35)25-10-5-6-11-26(25)38-2/h3-12,19-21,28,32H,13-18H2,1-2H3,(H,31,36)(H,33,37)/t21-,28-/m0/s1 |
| InChIKey | LPSRBVXXGUNMAT-KMRXNPHXSA-N |
| XLogP | 3.96 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|