C26H28F2N4O2S — CID 30888868
N-[(4-fluorophenyl)methyl]-N'-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 30888868) has the molecular formula C26H28F2N4O2S and a molecular weight of 498.60 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N'-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N'-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 30888868 |
| Molecular Formula | C26H28F2N4O2S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N'-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)NCc1ccc(F)cc1)[C@@H](c1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H28F2N4O2S/c1-18(30-26(34)25(33)29-17-19-8-10-20(27)11-9-19)24(23-7-4-16-35-23)32-14-12-31(13-15-32)22-6-3-2-5-21(22)28/h2-11,16,18,24H,12-15,17H2,1H3,(H,29,33)(H,30,34)/t18-,24-/m0/s1 |
| InChIKey | MYUVPTXVXYNBKF-UUOWRZLLSA-N |
| XLogP | 3.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|