C22H29FN4O2S — CID 92665853
N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[(4-fluorophenyl)methyl]oxamide (PubChem CID 92665853) has the molecular formula C22H29FN4O2S and a molecular weight of 432.57 g/mol. Its IUPAC name is N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[(4-fluorophenyl)methyl]oxamide.
| Compound Name | N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[(4-fluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 92665853 |
| Molecular Formula | C22H29FN4O2S |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[(4-fluorophenyl)methyl]oxamide |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@@H](C)NC(=O)C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H29FN4O2S/c1-3-26-10-12-27(13-11-26)20(19-5-4-14-30-19)16(2)25-22(29)21(28)24-15-17-6-8-18(23)9-7-17/h4-9,14,16,20H,3,10-13,15H2,1-2H3,(H,24,28)(H,25,29)/t16-,20+/m1/s1 |
| InChIKey | VKEBUWGYFCUQRH-UZLBHIALSA-N |
| XLogP | 2.39 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|