C23H32N4O3S — CID 28820914
N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 28820914) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 28820914 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N'-[(1S,2R)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@@H](C)NC(=O)C(=O)NCc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H32N4O3S/c1-4-26-11-13-27(14-12-26)21(20-6-5-15-31-20)17(2)25-23(29)22(28)24-16-18-7-9-19(30-3)10-8-18/h5-10,15,17,21H,4,11-14,16H2,1-3H3,(H,24,28)(H,25,29)/t17-,21+/m1/s1 |
| InChIKey | XQZOPPAVPCKYKH-UTKZUKDTSA-N |
| XLogP | 2.26 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|