C25H29N5O2S — CID 28821069
N'-[(1R,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-2-ylmethyl)oxamide (PubChem CID 28821069) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is N'-[(1R,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N'-[(1R,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 28821069 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N'-[(1R,2R)-1-(4-phenylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-N-(pyridin-2-ylmethyl)oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)NCc1ccccn1)[C@H](c1cccs1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N5O2S/c1-19(28-25(32)24(31)27-18-20-8-5-6-12-26-20)23(22-11-7-17-33-22)30-15-13-29(14-16-30)21-9-3-2-4-10-21/h2-12,17,19,23H,13-16,18H2,1H3,(H,27,31)(H,28,32)/t19-,23-/m1/s1 |
| InChIKey | QQDYYQLBYLDUKB-AUSIDOKSSA-N |
| XLogP | 2.83 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|