C20H31N5O3 — CID 29344676
N'-(2-morpholin-4-ylethyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]oxamide (PubChem CID 29344676) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is N'-(2-morpholin-4-ylethyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]oxamide.
| Compound Name | N'-(2-morpholin-4-ylethyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 29344676 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | N'-(2-morpholin-4-ylethyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]oxamide |
| SMILES | O=C(NCCN1CCOCC1)C(=O)NCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H31N5O3/c26-19(20(27)22-7-9-24-14-16-28-17-15-24)21-6-8-23-10-12-25(13-11-23)18-4-2-1-3-5-18/h1-5H,6-17H2,(H,21,26)(H,22,27) |
| InChIKey | YJECWOHPYXKQQZ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|