C21H32FN5O3 — CID 29401175
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-N'-(2-morpholin-4-ylethyl)oxamide (PubChem CID 29401175) has the molecular formula C21H32FN5O3 and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-N'-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-N'-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 29401175 |
| Molecular Formula | C21H32FN5O3 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-N'-(2-morpholin-4-ylethyl)oxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(F)cc2)CC1)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C21H32FN5O3/c22-18-2-4-19(5-3-18)27-12-10-25(11-13-27)8-1-6-23-20(28)21(29)24-7-9-26-14-16-30-17-15-26/h2-5H,1,6-17H2,(H,23,28)(H,24,29) |
| InChIKey | OUJCGFIQLNRSBT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|