C23H27FN4O4 — CID 42390491
N'-(1,3-benzodioxol-5-ylmethyl)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42390491) has the molecular formula C23H27FN4O4 and a molecular weight of 442.49 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-ylmethyl)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-ylmethyl)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42390491 |
| Molecular Formula | C23H27FN4O4 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N'-(1,3-benzodioxol-5-ylmethyl)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(F)cc2)CC1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H27FN4O4/c24-18-3-5-19(6-4-18)28-12-10-27(11-13-28)9-1-8-25-22(29)23(30)26-15-17-2-7-20-21(14-17)32-16-31-20/h2-7,14H,1,8-13,15-16H2,(H,25,29)(H,26,30) |
| InChIKey | MGUGRVDMVGQEFW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|