C26H29FN4O5 — CID 50757756
2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide (PubChem CID 50757756) has the molecular formula C26H29FN4O5 and a molecular weight of 496.54 g/mol. Its IUPAC name is 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide.
| Compound Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 50757756 |
| Molecular Formula | C26H29FN4O5 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide |
| SMILES | O=C(COCc1cc(-c2ccc3c(c2)OCO3)on1)NCCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H29FN4O5/c27-20-3-5-22(6-4-20)31-12-10-30(11-13-31)9-1-8-28-26(32)17-33-16-21-15-24(36-29-21)19-2-7-23-25(14-19)35-18-34-23/h2-7,14-15H,1,8-13,16-18H2,(H,28,32) |
| InChIKey | JGVCHODVYVDODD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|