C22H25ClN4O4 — CID 42389792
N'-(1,3-benzodioxol-5-yl)-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42389792) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42389792 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(Cl)cc2)CC1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H25ClN4O4/c23-16-2-5-18(6-3-16)27-12-10-26(11-13-27)9-1-8-24-21(28)22(29)25-17-4-7-19-20(14-17)31-15-30-19/h2-7,14H,1,8-13,15H2,(H,24,28)(H,25,29) |
| InChIKey | QWDPSTQHOLXQHU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|