C21H23Cl2FN4O2 — CID 42389821
N'-(3-chloro-4-fluorophenyl)-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42389821) has the molecular formula C21H23Cl2FN4O2 and a molecular weight of 453.35 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42389821 |
| Molecular Formula | C21H23Cl2FN4O2 |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(Cl)cc2)CC1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C21H23Cl2FN4O2/c22-15-2-5-17(6-3-15)28-12-10-27(11-13-28)9-1-8-25-20(29)21(30)26-16-4-7-19(24)18(23)14-16/h2-7,14H,1,8-13H2,(H,25,29)(H,26,30) |
| InChIKey | QSRRZGNDGZNZCF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|