C19H29ClN4O2 — CID 42389873
N'-tert-butyl-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42389873) has the molecular formula C19H29ClN4O2 and a molecular weight of 380.92 g/mol. Its IUPAC name is N'-tert-butyl-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-tert-butyl-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42389873 |
| Molecular Formula | C19H29ClN4O2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N'-tert-butyl-N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)NCCCN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H29ClN4O2/c1-19(2,3)22-18(26)17(25)21-9-4-10-23-11-13-24(14-12-23)16-7-5-15(20)6-8-16/h5-8H,4,9-14H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | VKEAIQWKXFPRMM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|