C21H24Cl2N4O2 — CID 42269096
N'-(5-chloro-2-methylphenyl)-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 42269096) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is N'-(5-chloro-2-methylphenyl)-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-(5-chloro-2-methylphenyl)-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 42269096 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N'-(5-chloro-2-methylphenyl)-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=O)NCCN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H24Cl2N4O2/c1-15-2-3-17(23)14-19(15)25-21(29)20(28)24-8-9-26-10-12-27(13-11-26)18-6-4-16(22)5-7-18/h2-7,14H,8-13H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | OSLKCUFSRUMLDH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|