C20H25ClN4O2S — CID 42389811
N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]-N'-(thiophen-2-ylmethyl)oxamide (PubChem CID 42389811) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]-N'-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]-N'-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 42389811 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[3-[4-(4-chlorophenyl)piperazin-1-yl]propyl]-N'-(thiophen-2-ylmethyl)oxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(Cl)cc2)CC1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C20H25ClN4O2S/c21-16-4-6-17(7-5-16)25-12-10-24(11-13-25)9-2-8-22-19(26)20(27)23-15-18-3-1-14-28-18/h1,3-7,14H,2,8-13,15H2,(H,22,26)(H,23,27) |
| InChIKey | WYDIIIQKWHDNOB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|