C20H25N3O3S — CID 16892165
N-[3-(4-morpholin-4-ylphenyl)propyl]-N'-(thiophen-2-ylmethyl)oxamide (PubChem CID 16892165) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-[3-(4-morpholin-4-ylphenyl)propyl]-N'-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N-[3-(4-morpholin-4-ylphenyl)propyl]-N'-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 16892165 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[3-(4-morpholin-4-ylphenyl)propyl]-N'-(thiophen-2-ylmethyl)oxamide |
| SMILES | O=C(NCCCc1ccc(N2CCOCC2)cc1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C20H25N3O3S/c24-19(20(25)22-15-18-4-2-14-27-18)21-9-1-3-16-5-7-17(8-6-16)23-10-12-26-13-11-23/h2,4-8,14H,1,3,9-13,15H2,(H,21,24)(H,22,25) |
| InChIKey | RJPSBFVOZZTMEU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|