C21H32N4O4 — CID 16892160
N'-(2-morpholin-4-ylethyl)-N-[3-(4-morpholin-4-ylphenyl)propyl]oxamide (PubChem CID 16892160) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is N'-(2-morpholin-4-ylethyl)-N-[3-(4-morpholin-4-ylphenyl)propyl]oxamide.
| Compound Name | N'-(2-morpholin-4-ylethyl)-N-[3-(4-morpholin-4-ylphenyl)propyl]oxamide |
|---|---|
| PubChem CID | 16892160 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | N'-(2-morpholin-4-ylethyl)-N-[3-(4-morpholin-4-ylphenyl)propyl]oxamide |
| SMILES | O=C(NCCCc1ccc(N2CCOCC2)cc1)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C21H32N4O4/c26-20(21(27)23-8-9-24-10-14-28-15-11-24)22-7-1-2-18-3-5-19(6-4-18)25-12-16-29-17-13-25/h3-6H,1-2,7-17H2,(H,22,26)(H,23,27) |
| InChIKey | ITUOEJCYPRBXER-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|