C16H23N3O4 — CID 108503044
N-[2-(4-hydroxyphenyl)ethyl]-N'-(2-morpholin-4-ylethyl)oxamide (PubChem CID 108503044) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-N'-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-N'-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108503044 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-N'-(2-morpholin-4-ylethyl)oxamide |
| SMILES | O=C(NCCc1ccc(O)cc1)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H23N3O4/c20-14-3-1-13(2-4-14)5-6-17-15(21)16(22)18-7-8-19-9-11-23-12-10-19/h1-4,20H,5-12H2,(H,17,21)(H,18,22) |
| InChIKey | WCYQONMEDWOAEK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|