C16H21Cl2N3O3 — CID 108984345
N-[2-(2,4-dichlorophenyl)ethyl]-N'-(2-morpholin-4-ylethyl)oxamide (PubChem CID 108984345) has the molecular formula C16H21Cl2N3O3 and a molecular weight of 374.27 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-N'-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-N'-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108984345 |
| Molecular Formula | C16H21Cl2N3O3 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-N'-(2-morpholin-4-ylethyl)oxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H21Cl2N3O3/c17-13-2-1-12(14(18)11-13)3-4-19-15(22)16(23)20-5-6-21-7-9-24-10-8-21/h1-2,11H,3-10H2,(H,19,22)(H,20,23) |
| InChIKey | JOJTZZCXXXFDMN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|