C20H20Cl3N3O3 — CID 991469
2,4-dichloro-N-[4-chloro-2-(2-morpholin-4-ylethylcarbamoyl)phenyl]benzamide (PubChem CID 991469) has the molecular formula C20H20Cl3N3O3 and a molecular weight of 456.76 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-chloro-2-(2-morpholin-4-ylethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-chloro-2-(2-morpholin-4-ylethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 991469 |
| Molecular Formula | C20H20Cl3N3O3 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 2,4-dichloro-N-[4-chloro-2-(2-morpholin-4-ylethylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)NCCN1CCOCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl3N3O3/c21-13-2-4-18(25-20(28)15-3-1-14(22)12-17(15)23)16(11-13)19(27)24-5-6-26-7-9-29-10-8-26/h1-4,11-12H,5-10H2,(H,24,27)(H,25,28) |
| InChIKey | UHGPSXSHLBRLKA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |