C17H26N4O5S — CID 108518499
N-(3-morpholin-4-ylpropyl)-N'-[2-(4-sulfamoylphenyl)ethyl]oxamide (PubChem CID 108518499) has the molecular formula C17H26N4O5S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-N'-[2-(4-sulfamoylphenyl)ethyl]oxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-N'-[2-(4-sulfamoylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108518499 |
| Molecular Formula | C17H26N4O5S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-N'-[2-(4-sulfamoylphenyl)ethyl]oxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C(=O)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C17H26N4O5S/c18-27(24,25)15-4-2-14(3-5-15)6-8-20-17(23)16(22)19-7-1-9-21-10-12-26-13-11-21/h2-5H,1,6-13H2,(H,19,22)(H,20,23)(H2,18,24,25) |
| InChIKey | JWANBYSXTJLQEX-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|