C15H24N4O4S — CID 108988277
1-(2-morpholin-4-ylethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 108988277) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108988277 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C15H24N4O4S/c16-24(21,22)14-3-1-13(2-4-14)5-6-17-15(20)18-7-8-19-9-11-23-12-10-19/h1-4H,5-12H2,(H2,16,21,22)(H2,17,18,20) |
| InChIKey | NGPNSEAGJULJLY-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |