C20H23F3N4O4S — CID 55695199
1-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 55695199) has the molecular formula C20H23F3N4O4S and a molecular weight of 472.49 g/mol. Its IUPAC name is 1-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55695199 |
| Molecular Formula | C20H23F3N4O4S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 1-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3-[2-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)Nc2cc(C(F)(F)F)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23F3N4O4S/c21-20(22,23)15-3-6-18(27-9-11-31-12-10-27)17(13-15)26-19(28)25-8-7-14-1-4-16(5-2-14)32(24,29)30/h1-6,13H,7-12H2,(H2,24,29,30)(H2,25,26,28) |
| InChIKey | GROFVCCCLGQKLU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |