C20H29F3N4O3 — CID 3514571
2-(3-morpholin-4-ylpropylamino)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 3514571) has the molecular formula C20H29F3N4O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 2-(3-morpholin-4-ylpropylamino)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-morpholin-4-ylpropylamino)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3514571 |
| Molecular Formula | C20H29F3N4O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-(3-morpholin-4-ylpropylamino)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CNCCCN1CCOCC1)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H29F3N4O3/c21-20(22,23)16-2-3-18(27-8-12-30-13-9-27)17(14-16)25-19(28)15-24-4-1-5-26-6-10-29-11-7-26/h2-3,14,24H,1,4-13,15H2,(H,25,28) |
| InChIKey | UMOWACQENIKNMK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|