C19H14F8N2O2 — CID 24554961
N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 24554961) has the molecular formula C19H14F8N2O2 and a molecular weight of 454.32 g/mol. Its IUPAC name is N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 24554961 |
| Molecular Formula | C19H14F8N2O2 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H14F8N2O2/c20-14-10(15(21)17(23)18(24)16(14)22)8-13(30)28-11-7-9(19(25,26)27)1-2-12(11)29-3-5-31-6-4-29/h1-2,7H,3-6,8H2,(H,28,30) |
| InChIKey | YJKVGODPLXQGMF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|