C21H32F3N3O2 — CID 55437577
2-[bis(2-methylpropyl)amino]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 55437577) has the molecular formula C21H32F3N3O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-[bis(2-methylpropyl)amino]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[bis(2-methylpropyl)amino]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55437577 |
| Molecular Formula | C21H32F3N3O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 2-[bis(2-methylpropyl)amino]-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)CN(CC(=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1)CC(C)C |
| InChI | InChI=1S/C21H32F3N3O2/c1-15(2)12-26(13-16(3)4)14-20(28)25-18-11-17(21(22,23)24)5-6-19(18)27-7-9-29-10-8-27/h5-6,11,15-16H,7-10,12-14H2,1-4H3,(H,25,28) |
| InChIKey | BREVGSTZDONTMT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |