C22H25F3N4O5S — CID 90145351
1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 90145351) has the molecular formula C22H25F3N4O5S and a molecular weight of 514.53 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90145351 |
| Molecular Formula | C22H25F3N4O5S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H25F3N4O5S/c23-22(24,25)16-2-1-3-17(14-16)26-21(30)27-19-15-18(35(31,32)29-8-12-34-13-9-29)4-5-20(19)28-6-10-33-11-7-28/h1-5,14-15H,6-13H2,(H2,26,27,30) |
| InChIKey | HGBCZJCEXQDSBQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |