C22H27F3N4O3S — CID 4094712
1-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 4094712) has the molecular formula C22H27F3N4O3S and a molecular weight of 484.54 g/mol. Its IUPAC name is 1-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 4094712 |
| Molecular Formula | C22H27F3N4O3S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 1-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(NC(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H27F3N4O3S/c1-3-29(4-2)33(31,32)18-10-11-20(28-12-5-6-13-28)19(15-18)27-21(30)26-17-9-7-8-16(14-17)22(23,24)25/h7-11,14-15H,3-6,12-13H2,1-2H3,(H2,26,27,30) |
| InChIKey | DKSUCJCTPVYTMU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |