C19H29N3O3S — CID 7551410
N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]cyclobutanecarboxamide (PubChem CID 7551410) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]cyclobutanecarboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 7551410 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]cyclobutanecarboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(NC(=O)C2CCC2)c1 |
| InChI | InChI=1S/C19H29N3O3S/c1-3-22(4-2)26(24,25)16-10-11-18(21-12-5-6-13-21)17(14-16)20-19(23)15-8-7-9-15/h10-11,14-15H,3-9,12-13H2,1-2H3,(H,20,23) |
| InChIKey | WWIHFBKOTWGXGU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |