C23H36N4O5S — CID 31504732
ethyl 4-[[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 31504732) has the molecular formula C23H36N4O5S and a molecular weight of 480.63 g/mol. Its IUPAC name is ethyl 4-[[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 31504732 |
| Molecular Formula | C23H36N4O5S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | ethyl 4-[[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)Nc2cc(S(=O)(=O)N(CC)CC)ccc2N2CCCC2)CC1 |
| InChI | InChI=1S/C23H36N4O5S/c1-4-27(5-2)33(30,31)19-9-10-21(25-13-7-8-14-25)20(17-19)24-22(28)18-11-15-26(16-12-18)23(29)32-6-3/h9-10,17-18H,4-8,11-16H2,1-3H3,(H,24,28) |
| InChIKey | YVLJOKCGBQVTQV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |