C18H26F3N3O3S2 — CID 55667323
N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 55667323) has the molecular formula C18H26F3N3O3S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55667323 |
| Molecular Formula | C18H26F3N3O3S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCCC2)c(NC(=O)CSC(F)(F)F)c1 |
| InChI | InChI=1S/C18H26F3N3O3S2/c1-3-24(4-2)29(26,27)14-8-9-16(23-10-6-5-7-11-23)15(12-14)22-17(25)13-28-18(19,20)21/h8-9,12H,3-7,10-11,13H2,1-2H3,(H,22,25) |
| InChIKey | CWFHDWAUMKZZMJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |