C17H29N5O3S — CID 119829594
2-amino-N-[5-(diethylsulfamoyl)-2-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 119829594) has the molecular formula C17H29N5O3S and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-amino-N-[5-(diethylsulfamoyl)-2-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-amino-N-[5-(diethylsulfamoyl)-2-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 119829594 |
| Molecular Formula | C17H29N5O3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-amino-N-[5-(diethylsulfamoyl)-2-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(C)CC2)c(NC(=O)CN)c1 |
| InChI | InChI=1S/C17H29N5O3S/c1-4-22(5-2)26(24,25)14-6-7-16(15(12-14)19-17(23)13-18)21-10-8-20(3)9-11-21/h6-7,12H,4-5,8-11,13,18H2,1-3H3,(H,19,23) |
| InChIKey | JHBSGZUQJYACOF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |