C25H36N4O3S — CID 17431519
N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]-2-(4-methylphenyl)acetamide (PubChem CID 17431519) has the molecular formula C25H36N4O3S and a molecular weight of 472.66 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17431519 |
| Molecular Formula | C25H36N4O3S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]-2-(4-methylphenyl)acetamide |
| SMILES | CCN1CCN(c2ccc(S(=O)(=O)N(CC)CC)cc2NC(=O)Cc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C25H36N4O3S/c1-5-27-14-16-28(17-15-27)24-13-12-22(33(31,32)29(6-2)7-3)19-23(24)26-25(30)18-21-10-8-20(4)9-11-21/h8-13,19H,5-7,14-18H2,1-4H3,(H,26,30) |
| InChIKey | TXZLTNRQFAOHJF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |