C22H32N4O4S — CID 55383928
N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]-2-methylfuran-3-carboxamide (PubChem CID 55383928) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 55383928 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]-2-methylfuran-3-carboxamide |
| SMILES | CCN1CCN(c2ccc(S(=O)(=O)N(CC)CC)cc2NC(=O)c2ccoc2C)CC1 |
| InChI | InChI=1S/C22H32N4O4S/c1-5-24-11-13-25(14-12-24)21-9-8-18(31(28,29)26(6-2)7-3)16-20(21)23-22(27)19-10-15-30-17(19)4/h8-10,15-16H,5-7,11-14H2,1-4H3,(H,23,27) |
| InChIKey | PQPBSAMTBUAIFK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |