C22H31N5O3S — CID 4851065
N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]pyridine-2-carboxamide (PubChem CID 4851065) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 4851065 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(4-ethylpiperazin-1-yl)phenyl]pyridine-2-carboxamide |
| SMILES | CCN1CCN(c2ccc(S(=O)(=O)N(CC)CC)cc2NC(=O)c2ccccn2)CC1 |
| InChI | InChI=1S/C22H31N5O3S/c1-4-25-13-15-26(16-14-25)21-11-10-18(31(29,30)27(5-2)6-3)17-20(21)24-22(28)19-9-7-8-12-23-19/h7-12,17H,4-6,13-16H2,1-3H3,(H,24,28) |
| InChIKey | HQTPMNLMWRMVOL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |