C23H27N3O4S — CID 26880925
N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-1-benzofuran-2-carboxamide (PubChem CID 26880925) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 26880925 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]-1-benzofuran-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(NC(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C23H27N3O4S/c1-3-26(4-2)31(28,29)18-11-12-20(25-13-7-8-14-25)19(16-18)24-23(27)22-15-17-9-5-6-10-21(17)30-22/h5-6,9-12,15-16H,3-4,7-8,13-14H2,1-2H3,(H,24,27) |
| InChIKey | NVFQVLDEMBDWQI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |