C24H29N3O4S2 — CID 4826340
N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]naphthalene-2-sulfonamide (PubChem CID 4826340) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 4826340 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-pyrrolidin-1-ylphenyl]naphthalene-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(NS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C24H29N3O4S2/c1-3-27(4-2)33(30,31)22-13-14-24(26-15-7-8-16-26)23(18-22)25-32(28,29)21-12-11-19-9-5-6-10-20(19)17-21/h5-6,9-14,17-18,25H,3-4,7-8,15-16H2,1-2H3 |
| InChIKey | WVKILUFCWSEHQQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |