C20H22N4O2S — CID 122356520
N-(4,6-dimethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)naphthalene-2-sulfonamide (PubChem CID 122356520) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)naphthalene-2-sulfonamide.
| Compound Name | N-(4,6-dimethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 122356520 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(4,6-dimethyl-2-pyrrolidin-1-ylpyrimidin-5-yl)naphthalene-2-sulfonamide |
| SMILES | Cc1nc(N2CCCC2)nc(C)c1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H22N4O2S/c1-14-19(15(2)22-20(21-14)24-11-5-6-12-24)23-27(25,26)18-10-9-16-7-3-4-8-17(16)13-18/h3-4,7-10,13,23H,5-6,11-12H2,1-2H3 |
| InChIKey | GYGUOBXLQQUQAW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |