C20H19ClN2O2 — CID 7922537
N-(5-chloro-2-piperidin-1-ylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 7922537) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-(5-chloro-2-piperidin-1-ylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(5-chloro-2-piperidin-1-ylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7922537 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-(5-chloro-2-piperidin-1-ylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCCCC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H19ClN2O2/c21-15-8-9-17(23-10-4-1-5-11-23)16(13-15)22-20(24)19-12-14-6-2-3-7-18(14)25-19/h2-3,6-9,12-13H,1,4-5,10-11H2,(H,22,24) |
| InChIKey | JLQJPRPBNIRHHY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |