C20H21ClN3O2+ — CID 2670112
N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 2670112) has the molecular formula C20H21ClN3O2+ and a molecular weight of 370.86 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2670112 |
| Molecular Formula | C20H21ClN3O2+ |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | C[NH+]1CCN(c2ccc(Cl)cc2NC(=O)c2cc3ccccc3o2)CC1 |
| InChI | InChI=1S/C20H20ClN3O2/c1-23-8-10-24(11-9-23)17-7-6-15(21)13-16(17)22-20(25)19-12-14-4-2-3-5-18(14)26-19/h2-7,12-13H,8-11H2,1H3,(H,22,25)/p+1 |
| InChIKey | SKMBNBYXZUAEQH-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 49.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |