C16H23ClN3O+ — CID 2680095
N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]cyclobutanecarboxamide (PubChem CID 2680095) has the molecular formula C16H23ClN3O+ and a molecular weight of 308.83 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]cyclobutanecarboxamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 2680095 |
| Molecular Formula | C16H23ClN3O+ |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]cyclobutanecarboxamide |
| SMILES | C[NH+]1CCN(c2ccc(Cl)cc2NC(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C16H22ClN3O/c1-19-7-9-20(10-8-19)15-6-5-13(17)11-14(15)18-16(21)12-3-2-4-12/h5-6,11-12H,2-4,7-10H2,1H3,(H,18,21)/p+1 |
| InChIKey | UOECJHRCEWJJJF-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |