C16H21ClN2O3S — CID 16566635
N-(5-chloro-2-piperidin-1-ylphenyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 16566635) has the molecular formula C16H21ClN2O3S and a molecular weight of 356.88 g/mol. Its IUPAC name is N-(5-chloro-2-piperidin-1-ylphenyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(5-chloro-2-piperidin-1-ylphenyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 16566635 |
| Molecular Formula | C16H21ClN2O3S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-(5-chloro-2-piperidin-1-ylphenyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21ClN2O3S/c17-13-4-5-15(19-7-2-1-3-8-19)14(10-13)18-16(20)12-6-9-23(21,22)11-12/h4-5,10,12H,1-3,6-9,11H2,(H,18,20) |
| InChIKey | VVIDDIHMPDQREJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |