C16H22N2O3S — CID 40952898
(3R)-1,1-dioxo-N-(4-piperidin-1-ylphenyl)thiolane-3-carboxamide (PubChem CID 40952898) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (3R)-1,1-dioxo-N-(4-piperidin-1-ylphenyl)thiolane-3-carboxamide.
| Compound Name | (3R)-1,1-dioxo-N-(4-piperidin-1-ylphenyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 40952898 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (3R)-1,1-dioxo-N-(4-piperidin-1-ylphenyl)thiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O3S/c19-16(13-8-11-22(20,21)12-13)17-14-4-6-15(7-5-14)18-9-2-1-3-10-18/h4-7,13H,1-3,8-12H2,(H,17,19)/t13-/m0/s1 |
| InChIKey | QOXMVTXAAFBOJX-ZDUSSCGKSA-N |
| XLogP | 2.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|