C12H15NO4S — CID 64793559
N-[4-(hydroxymethyl)phenyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 64793559) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)phenyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[4-(hydroxymethyl)phenyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 64793559 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-[4-(hydroxymethyl)phenyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(CO)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15NO4S/c14-7-9-1-3-11(4-2-9)13-12(15)10-5-6-18(16,17)8-10/h1-4,10,14H,5-8H2,(H,13,15) |
| InChIKey | SRIAPZBOHJDMJD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |